2-(4a,8-Dimethyl-1,2,3,4,4a,5,6,7-octahydro-naphthalen-2-yl)-prop-2-en-1-ol
| Internal ID | 01adcce9-348f-47bd-b261-d832c0c0e5d1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| IUPAC Name | 2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)prop-2-en-1-ol |
| SMILES (Canonical) | CC1=C2CC(CCC2(CCC1)C)C(=C)CO |
| SMILES (Isomeric) | CC1=C2CC(CCC2(CCC1)C)C(=C)CO |
| InChI | InChI=1S/C15H24O/c1-11-5-4-7-15(3)8-6-13(9-14(11)15)12(2)10-16/h13,16H,2,4-10H2,1,3H3 |
| InChI Key | ITRHZWKEZJYJQO-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.182715385 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.70 |
| ITRHZWKEZJYJQO-UHFFFAOYSA-N |
| 4,11(13)-Eudesmadien-12-ol |
| 2-(4a,8-Dimethyl-1,2,3,4,4a,5,6,7-octahydro-2-naphthalenyl)-2-propen-1-ol # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.88% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.69% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.11% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.54% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.25% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.96% | 95.50% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 83.82% | 97.64% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.63% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.04% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.67% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.08% | 98.95% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.07% | 86.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.04% | 94.75% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.73% | 95.34% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.00% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia annua |
| Artemisia carvifolia |
| Atractylodes lancea |
| Atractylodes macrocephala |
| Aucklandia costus |
| PubChem | 579791 |
| NPASS | NPC135718 |
| LOTUS | LTS0116038 |
| wikiData | Q105120250 |