2-(4,7-Dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl)prop-2-en-1-ol
Internal ID | f368519b-5bce-45a3-b26c-f26418c37aa7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 2-(4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl)prop-2-en-1-ol |
SMILES (Canonical) | CC1CCC(C2C1CCC(=C2)C)C(=C)CO |
SMILES (Isomeric) | CC1CCC(C2C1CCC(=C2)C)C(=C)CO |
InChI | InChI=1S/C15H24O/c1-10-4-6-13-11(2)5-7-14(12(3)9-16)15(13)8-10/h8,11,13-16H,3-7,9H2,1-2H3 |
InChI Key | CZSSHKCZSDDOAH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24O |
Molecular Weight | 220.35 g/mol |
Exact Mass | 220.182715385 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 3.80 |
CZSSHKCZSDDOAH-UHFFFAOYSA-N |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.06% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.47% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.63% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.11% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.83% | 100.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.98% | 94.80% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.34% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.23% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 81.38% | 98.95% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.88% | 86.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.04% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nolana coelestis |
Plagiochasma rupestre |
PubChem | 73211544 |
LOTUS | LTS0131323 |
wikiData | Q104973123 |