2-(4,7-Dihydroxy-2-methoxy-9,10-dihydrophenanthren-1-yl)-7-methoxy-9,10-dihydrophenanthrene-3,5-diol
| Internal ID | ff09b926-4df9-465c-918a-1ac7f7eeb2a1 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 2-(4,7-dihydroxy-2-methoxy-9,10-dihydrophenanthren-1-yl)-7-methoxy-9,10-dihydrophenanthrene-3,5-diol |
| SMILES (Canonical) | COC1=CC2=C(C3=CC(=C(C=C3CC2)C4=C(C=C(C5=C4CCC6=C5C=CC(=C6)O)O)OC)O)C(=C1)O |
| SMILES (Isomeric) | COC1=CC2=C(C3=CC(=C(C=C3CC2)C4=C(C=C(C5=C4CCC6=C5C=CC(=C6)O)O)OC)O)C(=C1)O |
| InChI | InChI=1S/C30H26O6/c1-35-19-10-17-4-3-16-11-23(24(32)13-22(16)28(17)25(33)12-19)30-21-7-5-15-9-18(31)6-8-20(15)29(21)26(34)14-27(30)36-2/h6,8-14,31-34H,3-5,7H2,1-2H3 |
| InChI Key | JHQHJDNDZVFFDC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 97.93% | 98.35% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.64% | 91.49% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.84% | 91.79% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.55% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.39% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.83% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.24% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.11% | 93.40% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.26% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 90.56% | 91.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.24% | 86.33% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 88.62% | 82.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.70% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.50% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.27% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.12% | 93.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.10% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.65% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.44% | 95.89% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.61% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 81.85% | 90.71% |
| CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 81.53% | 86.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.92% | 94.45% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 80.50% | 98.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bulbophyllum odoratissimum |
| PubChem | 148057841 |
| LOTUS | LTS0142465 |
| wikiData | Q105128158 |