2-(4,5-Dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-enyl)chromen-4-one
Internal ID | c1d43649-7fdb-48a5-a948-369c0c373e96 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 8-prenylated flavones |
IUPAC Name | 2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-enyl)chromen-4-one |
SMILES (Canonical) | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC(=C(C=C3OC)O)O)CC=C(C)C)C |
SMILES (Isomeric) | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC(=C(C=C3OC)O)O)CC=C(C)C)C |
InChI | InChI=1S/C26H28O7/c1-13(2)6-8-15-18(27)11-21(30)23-24(31)16(9-7-14(3)4)25(33-26(15)23)17-10-19(28)20(29)12-22(17)32-5/h6-7,10-12,27-30H,8-9H2,1-5H3 |
InChI Key | CHTVZEGPHZDBTO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O7 |
Molecular Weight | 452.50 g/mol |
Exact Mass | 452.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 6.10 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.32% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.21% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.47% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.32% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.14% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.62% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.53% | 96.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.68% | 91.49% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.10% | 89.34% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.97% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.79% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.78% | 96.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.77% | 97.28% |
CHEMBL3194 | P02766 | Transthyretin | 82.83% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.40% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 80.49% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus nobilis |
PubChem | 163010099 |
LOTUS | LTS0222104 |
wikiData | Q104959275 |