2-[4-(methylamino)phenyl]-1H-quinazolin-4-one
| Internal ID | cc66fb27-009f-40af-83d9-48641a5acb8c |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
| IUPAC Name | 2-[4-(methylamino)phenyl]-1H-quinazolin-4-one |
| SMILES (Canonical) | CNC1=CC=C(C=C1)C2=NC(=O)C3=CC=CC=C3N2 |
| SMILES (Isomeric) | CNC1=CC=C(C=C1)C2=NC(=O)C3=CC=CC=C3N2 |
| InChI | InChI=1S/C15H13N3O/c1-16-11-8-6-10(7-9-11)14-17-13-5-3-2-4-12(13)15(19)18-14/h2-9,16H,1H3,(H,17,18,19) |
| InChI Key | HPAJBWPBFGTJFP-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.105862047 g/mol |
| Topological Polar Surface Area (TPSA) | 53.50 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 2-[4-(methylamino)phenyl]-1H-quinazolin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-methylaminophenyl-1h-quinazolin-4-one.jpg "2D Structure of 2-[4-(methylamino)phenyl]-1H-quinazolin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.37% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.63% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.74% | 94.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.61% | 98.59% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.85% | 94.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.51% | 92.98% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 88.37% | 85.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.47% | 94.73% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 85.62% | 95.70% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.89% | 96.67% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 83.85% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.37% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.33% | 91.11% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.75% | 92.67% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.40% | 96.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.39% | 92.97% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.88% | 95.83% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.63% | 91.49% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.19% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53360346 |
| LOTUS | LTS0033569 |
| wikiData | Q27138156 |