{2-[4-Methyl-2-(2-methylpropoxy)phenyl]oxiran-2-yl}methanol
| Internal ID | 28aef167-cc8e-4deb-8898-eaec9e76df78 |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | [2-[4-methyl-2-(2-methylpropoxy)phenyl]oxiran-2-yl]methanol |
| SMILES (Canonical) | CC1=CC(=C(C=C1)C2(CO2)CO)OCC(C)C |
| SMILES (Isomeric) | CC1=CC(=C(C=C1)C2(CO2)CO)OCC(C)C |
| InChI | InChI=1S/C14H20O3/c1-10(2)7-16-13-6-11(3)4-5-12(13)14(8-15)9-17-14/h4-6,10,15H,7-9H2,1-3H3 |
| InChI Key | ZKYVUFXMPSROAT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 42.00 Ų |
| XlogP | 2.20 |
| DTXSID80831112 |
| {2-[4-Methyl-2-(2-methylpropoxy)phenyl]oxiran-2-yl}methanol |
![2D Structure of {2-[4-Methyl-2-(2-methylpropoxy)phenyl]oxiran-2-yl}methanol](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-methyl-2-2-methylpropoxyphenyloxiran-2-ylmethanol.jpg "2D Structure of {2-[4-Methyl-2-(2-methylpropoxy)phenyl]oxiran-2-yl}methanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.20% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.62% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 94.18% | 90.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.64% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.95% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.65% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.62% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.41% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.82% | 96.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.43% | 93.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.24% | 95.89% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.00% | 97.21% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.66% | 94.80% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.95% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.66% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.33% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.81% | 94.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.56% | 89.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.35% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calea sickii |
| PubChem | 71411504 |
| LOTUS | LTS0199424 |
| wikiData | Q82816928 |