2-(4-Hydroxyphenyl)naphthalic anhydride
Internal ID | 1a183319-b884-4f7e-bc3d-2952e496ca55 |
Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
IUPAC Name | 6-(4-hydroxyphenyl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
SMILES (Canonical) | C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)C4=CC=C(C=C4)O |
SMILES (Isomeric) | C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)C4=CC=C(C=C4)O |
InChI | InChI=1S/C18H10O4/c19-12-7-4-10(5-8-12)13-9-6-11-2-1-3-14-15(11)16(13)18(21)22-17(14)20/h1-9,19H |
InChI Key | YFQUGKAERRJRCN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H10O4 |
Molecular Weight | 290.30 g/mol |
Exact Mass | 290.05790880 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 3.80 |
CHEBI:168750 |
4-(4-Hydroxyphenyl)-1H,3H-naphtho[1,8-cd]pyran-1,3-dione |
DTXSID601198971 |
158922-28-2 |
6-(4-hydroxyphenyl)-3-oxatricyclo[7.3.1.0^{5,13}]trideca-1(13),5,7,9,11-pentaene-2,4-dione |
6-(4-hydroxyphenyl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
![2D Structure of 2-(4-Hydroxyphenyl)naphthalic anhydride 2D Structure of 2-(4-Hydroxyphenyl)naphthalic anhydride](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-hydroxyphenylnaphthalic-anhydride.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.98% | 98.95% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.51% | 98.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.86% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.85% | 91.49% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.80% | 91.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.56% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.51% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.46% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.33% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.75% | 99.15% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 87.63% | 96.09% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.58% | 93.31% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.24% | 93.10% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.19% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.40% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.11% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.01% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Musa acuminata |
Musa balbisiana |
PubChem | 10424295 |
LOTUS | LTS0167309 |
wikiData | Q105347752 |