2-(4-Hydroxyphenyl)furo[2,3-h]chromen-4-one
| Internal ID | 36ba815b-8715-4052-a981-4160f29b7a47 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Furanoflavones |
| IUPAC Name | 2-(4-hydroxyphenyl)furo[2,3-h]chromen-4-one |
| SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C4=C(C=C3)OC=C4)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C4=C(C=C3)OC=C4)O |
| InChI | InChI=1S/C17H10O4/c18-11-3-1-10(2-4-11)16-9-14(19)12-5-6-15-13(7-8-20-15)17(12)21-16/h1-9,18H |
| InChI Key | GRGLQFYIJKENQC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H10O4 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 59.70 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 2-(4-Hydroxyphenyl)furo[2,3-h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-hydroxyphenylfuro23-hchromen-4-one.jpg "2D Structure of 2-(4-Hydroxyphenyl)furo[2,3-h]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.69% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.19% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.87% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.30% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.92% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.59% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.56% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.98% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.67% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.69% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.99% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.21% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 83.14% | 90.71% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 82.79% | 95.71% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 80.73% | 95.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pongamia pinnata |
| PubChem | 11033182 |
| LOTUS | LTS0068216 |
| wikiData | Q105015897 |