2-(4-hydroxyphenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-9-ol
| Internal ID | 79a78972-e5e7-4b0f-9ee3-93bee5514436 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans |
| IUPAC Name | 2-(4-hydroxyphenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-9-ol |
| SMILES (Canonical) | CC1(C(CC2=C(O1)C=CC3=C2OC(CC3)C4=CC=C(C=C4)O)O)C |
| SMILES (Isomeric) | CC1(C(CC2=C(O1)C=CC3=C2OC(CC3)C4=CC=C(C=C4)O)O)C |
| InChI | InChI=1S/C20H22O4/c1-20(2)18(22)11-15-17(24-20)10-6-13-5-9-16(23-19(13)15)12-3-7-14(21)8-4-12/h3-4,6-8,10,16,18,21-22H,5,9,11H2,1-2H3 |
| InChI Key | MWPKKKZPSWEABN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 2-(4-hydroxyphenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-9-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-hydroxyphenyl-88-dimethyl-34910-tetrahydro-2h-pyrano23-fchromen-9-ol.jpg "2D Structure of 2-(4-hydroxyphenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-9-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.01% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.34% | 97.09% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.84% | 89.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.99% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.60% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.12% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.50% | 95.56% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.46% | 95.78% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.28% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.79% | 98.95% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.49% | 91.79% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.90% | 85.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.20% | 85.11% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.13% | 95.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.79% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.79% | 91.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.32% | 92.94% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 82.70% | 88.48% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.73% | 85.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.20% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Amentotaxus formosana |
| Brosimum acutifolium |
| PubChem | 163040070 |
| LOTUS | LTS0159173 |
| wikiData | Q105176461 |