2-(4-hydroxyphenyl)-8-methoxy-3,4-dihydro-2H-chromen-7-ol
| Internal ID | 8c6801ec-26ea-4a9b-a630-2c73e54e4d73 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
| IUPAC Name | 2-(4-hydroxyphenyl)-8-methoxy-3,4-dihydro-2H-chromen-7-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H16O4/c1-19-16-13(18)8-4-11-5-9-14(20-15(11)16)10-2-6-12(17)7-3-10/h2-4,6-8,14,17-18H,5,9H2,1H3 |
| InChI Key | OVJRDXJZMGYZOM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.47% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.95% | 97.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.00% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.86% | 95.56% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.85% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.32% | 95.89% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 83.09% | 98.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.83% | 99.17% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.48% | 82.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.08% | 95.89% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.97% | 95.78% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.93% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.81% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.75% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.73% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dracaena draco |
| PubChem | 163006620 |
| LOTUS | LTS0095782 |
| wikiData | Q105200766 |