2-(4-Hydroxyphenyl)-6-methoxy-1-methylquinolin-4-one
| Internal ID | 49d04bbc-d36a-4cac-91e5-656b25b73186 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Phenylquinolines |
| IUPAC Name | 2-(4-hydroxyphenyl)-6-methoxy-1-methylquinolin-4-one |
| SMILES (Canonical) | CN1C2=C(C=C(C=C2)OC)C(=O)C=C1C3=CC=C(C=C3)O |
| SMILES (Isomeric) | CN1C2=C(C=C(C=C2)OC)C(=O)C=C1C3=CC=C(C=C3)O |
| InChI | InChI=1S/C17H15NO3/c1-18-15-8-7-13(21-2)9-14(15)17(20)10-16(18)11-3-5-12(19)6-4-11/h3-10,19H,1-2H3 |
| InChI Key | COFCROPUZBFJMG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.86% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.62% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.00% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.45% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.98% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.92% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.55% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.93% | 93.31% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.25% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.93% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.36% | 93.40% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.83% | 93.99% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.57% | 86.92% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.54% | 95.53% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.24% | 93.10% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 82.84% | 88.48% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.18% | 89.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.15% | 92.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.82% | 99.17% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 81.22% | 93.24% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 80.62% | 98.35% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.59% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.36% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.08% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Skimmia reevesiana |
| PubChem | 86150909 |
| LOTUS | LTS0050774 |
| wikiData | Q104966839 |