2-(4-hydroxypent-2-en-2-yl)-6,7,9,9a-tetrahydro-1H-pyrido[1,2-a]pyrimidine-4,8-dione
| Internal ID | 569876ed-ad6a-41c1-a273-bee486d94317 |
| Taxonomy | Organoheterocyclic compounds > Pyridopyrimidines |
| IUPAC Name | 2-(4-hydroxypent-2-en-2-yl)-6,7,9,9a-tetrahydro-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H18N2O3/c1-8(5-9(2)16)11-7-13(18)15-4-3-10(17)6-12(15)14-11/h5,7,9,12,14,16H,3-4,6H2,1-2H3 |
| InChI Key | AKWHGMWEGVKZON-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13174244 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of 2-(4-hydroxypent-2-en-2-yl)-6,7,9,9a-tetrahydro-1H-pyrido[1,2-a]pyrimidine-4,8-dione](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-hydroxypent-2-en-2-yl-6799a-tetrahydro-1h-pyrido12-apyrimidine-48-dione.jpg "2D Structure of 2-(4-hydroxypent-2-en-2-yl)-6,7,9,9a-tetrahydro-1H-pyrido[1,2-a]pyrimidine-4,8-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.26% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.65% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.71% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.40% | 90.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.05% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.62% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.35% | 94.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.84% | 88.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.00% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.71% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.10% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.84% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.07% | 90.71% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.82% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.75% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.55% | 90.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.52% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.22% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85393671 |
| LOTUS | LTS0075349 |
| wikiData | Q103816209 |