2-(4-Hydroxy-3-methoxyphenyl)propanoic acid
| Internal ID | b2c0195b-c4cd-46aa-b081-9fe93e8a9cd6 |
| Taxonomy | Phenylpropanoids and polyketides > Phenylpropanoic acids |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| SMILES (Canonical) | CC(C1=CC(=C(C=C1)O)OC)C(=O)O |
| SMILES (Isomeric) | CC(C1=CC(=C(C=C1)O)OC)C(=O)O |
| InChI | InChI=1S/C10H12O4/c1-6(10(12)13)7-3-4-8(11)9(5-7)14-2/h3-6,11H,1-2H3,(H,12,13) |
| InChI Key | CJBZBOQPGGQIOM-UHFFFAOYSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 0.90 |
| 56355-43-2 |
| SCHEMBL490839 |
| CJBZBOQPGGQIOM-UHFFFAOYSA-N |
| DTXSID801246825 |
| 4-hydroxy-3-methoxypheny propionic acid |
| 4-hydroxy-3-methoxyphenylpropionic acid |
| 2-(4-hydroxy-3-methoxy-phenyl)-propionic acid |
| EN300-1850459 |
| 4-Hydroxy-3-methoxy-alpha-methylbenzeneacetic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.42% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.37% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.70% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.18% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.64% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.37% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.28% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.70% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.59% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.95% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.48% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.86% | 89.62% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.62% | 90.71% |
| CHEMBL3194 | P02766 | Transthyretin | 82.25% | 90.71% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.57% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isatis tinctoria |
| PubChem | 18987074 |
| LOTUS | LTS0198104 |
| wikiData | Q104960840 |