2-[(4-Hydroxy-3-methoxyphenyl)methyl]octanamide
Internal ID | 64fac221-7ea6-475c-8e56-b9e52127232e |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 2-[(4-hydroxy-3-methoxyphenyl)methyl]octanamide |
SMILES (Canonical) | CCCCCCC(CC1=CC(=C(C=C1)O)OC)C(=O)N |
SMILES (Isomeric) | CCCCCCC(CC1=CC(=C(C=C1)O)OC)C(=O)N |
InChI | InChI=1S/C16H25NO3/c1-3-4-5-6-7-13(16(17)19)10-12-8-9-14(18)15(11-12)20-2/h8-9,11,13,18H,3-7,10H2,1-2H3,(H2,17,19) |
InChI Key | HFDCHUMVPUASRJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H25NO3 |
Molecular Weight | 279.37 g/mol |
Exact Mass | 279.18344366 g/mol |
Topological Polar Surface Area (TPSA) | 72.60 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.20% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 97.84% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.68% | 94.45% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.47% | 92.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.75% | 86.33% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.37% | 97.29% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.36% | 96.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.50% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 88.42% | 98.75% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.98% | 91.81% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.83% | 90.20% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.40% | 95.56% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.28% | 93.31% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.12% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.09% | 93.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.73% | 95.50% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.11% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.84% | 95.89% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.25% | 95.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.93% | 80.78% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.47% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 66978549 |
LOTUS | LTS0116671 |
wikiData | Q105027235 |