2-(4'-Hydroxy-3'-methoxyphenyl)-2-oxoacetamide
Internal ID | fb6686f3-0dae-4285-95ab-e170074ee3b6 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-2-oxoacetamide |
SMILES (Canonical) | COC1=C(C=CC(=C1)C(=O)C(=O)N)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C(=O)C(=O)N)O |
InChI | InChI=1S/C9H9NO4/c1-14-7-4-5(2-3-6(7)11)8(12)9(10)13/h2-4,11H,1H3,(H2,10,13) |
InChI Key | WYENAAOBQDROIB-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C9H9NO4 |
Molecular Weight | 195.17 g/mol |
Exact Mass | 195.05315777 g/mol |
Topological Polar Surface Area (TPSA) | 89.60 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.83% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.55% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.39% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.64% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.50% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 89.72% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 89.17% | 90.20% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.11% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 85.36% | 90.71% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 83.72% | 95.48% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.70% | 89.62% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.74% | 90.24% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.08% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Populus euphratica |
PubChem | 129881716 |
LOTUS | LTS0209437 |
wikiData | Q105322134 |