2-(4-Hydroxy-2-methoxyphenyl)-5-methoxy-1-benzofuran-6-ol
| Internal ID | b0e561d0-dcda-4b11-8a3b-48fd6d7a821a |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-(4-hydroxy-2-methoxyphenyl)-5-methoxy-1-benzofuran-6-ol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)O)C2=CC3=CC(=C(C=C3O2)O)OC |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)O)C2=CC3=CC(=C(C=C3O2)O)OC |
| InChI | InChI=1S/C16H14O5/c1-19-14-7-10(17)3-4-11(14)15-5-9-6-16(20-2)12(18)8-13(9)21-15/h3-8,17-18H,1-2H3 |
| InChI Key | DZCYWLFZZXXDTO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 72.10 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.64% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.49% | 98.35% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.00% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.52% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.05% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.75% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 88.08% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.14% | 89.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.63% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.56% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.30% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.03% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.37% | 90.24% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.64% | 96.09% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 82.02% | 91.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.53% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mucuna birdwoodiana |
| PubChem | 46177524 |
| LOTUS | LTS0173511 |
| wikiData | Q104991740 |