2-(4-Formylphenoxy)acetamide
| Internal ID | 0f9199ed-fa7c-4940-8d69-022399e58648 |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | 2-(4-formylphenoxy)acetamide |
| SMILES (Canonical) | C1=CC(=CC=C1C=O)OCC(=O)N |
| SMILES (Isomeric) | C1=CC(=CC=C1C=O)OCC(=O)N |
| InChI | InChI=1S/C9H9NO3/c10-9(12)6-13-8-3-1-7(5-11)2-4-8/h1-5H,6H2,(H2,10,12) |
| InChI Key | FLPJVCMIKUWSDR-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 69.40 Ų |
| XlogP | 0.10 |
| 135857-20-4 |
| 2-(4-Formyl-phenoxy)-acetamide |
| Acetamide, 2-(4-formylphenoxy)- |
| CETYLPALMITATE |
| Oprea1_602212 |
| SCHEMBL246234 |
| 2-(4-formylphenoxyl)acetamide |
| DTXSID20345061 |
| MFCD01050440 |
| AKOS000202106 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.28% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.81% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.17% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.01% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.71% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.23% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.85% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.52% | 94.45% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.99% | 89.34% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.87% | 96.12% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.57% | 94.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.67% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Siraitia grosvenorii |
| PubChem | 601630 |
| LOTUS | LTS0269895 |
| wikiData | Q82117296 |