[2-(4-Acetyloxy-3-methoxyphenyl)-3-(4-acetyloxyphenyl)propyl] acetate
Internal ID | cb90e2f3-ddf6-4a0f-a584-54f4f9110db4 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | [2-(4-acetyloxy-3-methoxyphenyl)-3-(4-acetyloxyphenyl)propyl] acetate |
SMILES (Canonical) | CC(=O)OCC(CC1=CC=C(C=C1)OC(=O)C)C2=CC(=C(C=C2)OC(=O)C)OC |
SMILES (Isomeric) | CC(=O)OCC(CC1=CC=C(C=C1)OC(=O)C)C2=CC(=C(C=C2)OC(=O)C)OC |
InChI | InChI=1S/C22H24O7/c1-14(23)27-13-19(11-17-5-8-20(9-6-17)28-15(2)24)18-7-10-21(29-16(3)25)22(12-18)26-4/h5-10,12,19H,11,13H2,1-4H3 |
InChI Key | LQVWLBNZBDVKMM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O7 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 88.10 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of [2-(4-Acetyloxy-3-methoxyphenyl)-3-(4-acetyloxyphenyl)propyl] acetate 2D Structure of [2-(4-Acetyloxy-3-methoxyphenyl)-3-(4-acetyloxyphenyl)propyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2-4-acetyloxy-3-methoxyphenyl-3-4-acetyloxyphenylpropyl-acetate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.47% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.15% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.96% | 90.20% |
CHEMBL2535 | P11166 | Glucose transporter | 93.35% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.12% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.76% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.97% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.53% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.89% | 91.11% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.07% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.01% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.99% | 92.62% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.08% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.48% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.12% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.72% | 96.95% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.69% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pinus taeda |
PubChem | 101932964 |
LOTUS | LTS0062732 |
wikiData | Q105155907 |