2-[(3E,6E)-nona-3,6-dienyl]-1H-quinolin-4-one
| Internal ID | 2f61bc2e-8e68-4e52-8268-2a0f0760fbbb |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 2-[(3E,6E)-nona-3,6-dienyl]-1H-quinolin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H21NO/c1-2-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19-15/h3-4,6-7,9-10,12-14H,2,5,8,11H2,1H3,(H,19,20)/b4-3+,7-6+ |
| InChI Key | XTVRYXAEHPUATN-FZWLCVONSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.162314293 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of 2-[(3E,6E)-nona-3,6-dienyl]-1H-quinolin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-3e6e-nona-36-dienyl-1h-quinolin-4-one.jpg "2D Structure of 2-[(3E,6E)-nona-3,6-dienyl]-1H-quinolin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.47% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.54% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.09% | 91.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 94.05% | 98.59% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 93.10% | 91.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.02% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.55% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.00% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.67% | 94.75% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.50% | 97.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.95% | 89.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.97% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.65% | 99.17% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.84% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vepris ampody |
| PubChem | 13970984 |
| LOTUS | LTS0069357 |
| wikiData | Q105341971 |