2-(3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)benzene-1,4-diol
Internal ID | 092fe30d-62d0-4d7b-8287-021718b9f1a4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,4-diol |
SMILES (Canonical) | CC(=CCCC(=CCCC(=CCC1=C(C=CC(=C1)O)O)C)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/CC/C(=C/CC1=C(C=CC(=C1)O)O)/C)/C)C |
InChI | InChI=1S/C21H30O2/c1-16(2)7-5-8-17(3)9-6-10-18(4)11-12-19-15-20(22)13-14-21(19)23/h7,9,11,13-15,22-23H,5-6,8,10,12H2,1-4H3/b17-9+,18-11+ |
InChI Key | KBCWHCBFYHSRRP-XURGJTJWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H30O2 |
Molecular Weight | 314.50 g/mol |
Exact Mass | 314.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 6.90 |
2-(3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)benzene-1,4-diol |
2-((2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)benzene-1,4-diol |
71258-97-4 |
2-farnesyl-hydroquinone |
CHEMBL511694 |
2-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl] benzene-1,4-diol |
![2D Structure of 2-(3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)benzene-1,4-diol 2D Structure of 2-(3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)benzene-1,4-diol](https://plantaedb.com/storage/docs/compounds/2023/11/2-3711-trimethyldodeca-2610-trien-1-ylbenzene-14-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.46% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.82% | 92.08% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.93% | 93.10% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.50% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 92.22% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.03% | 83.57% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.43% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.22% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.03% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.94% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.86% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.99% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.25% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pteris denticulata |
PubChem | 10358290 |
LOTUS | LTS0214278 |
wikiData | Q105138111 |