2-[2-(3,5-Dimethoxyphenyl)ethyl]phenol
| Internal ID | 9e79aa8d-49fd-4aa4-87fe-c65b178ddbad |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-[2-(3,5-dimethoxyphenyl)ethyl]phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H18O3/c1-18-14-9-12(10-15(11-14)19-2)7-8-13-5-3-4-6-16(13)17/h3-6,9-11,17H,7-8H2,1-2H3 |
| InChI Key | CUJQSBRMPIAHMC-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 3.70 |
| SCHEMBL8704118 |
| CUJQSBRMPIAHMC-UHFFFAOYSA-N |
| 2-(3,5-dimethoxyphenethyl)phenol |
| BDBM246489 |
| 3,5-Dimethoxy-2'hydroxybibenzyl (7) |
| 2-[2-(3,5-dimethoxyphenyl)ethyl]phenol |
![2D Structure of 2-[2-(3,5-Dimethoxyphenyl)ethyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/07/2-35-dimethoxyphenethylphenol.jpg "2D Structure of 2-[2-(3,5-Dimethoxyphenyl)ethyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.48% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.98% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.02% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.20% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.15% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.06% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.70% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.25% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.86% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.50% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.21% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.36% | 92.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.09% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.78% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus cordata |
| Aloe deltoideodonta |
| Bauhinia purpurea |
| Crinum latifolium |
| Dioscorea oppositifolia |
| Leitneria floridana |
| Notholaena aschenborniana |
| Thermopsis mollis |
| PubChem | 19423974 |
| NPASS | NPC69261 |
| ChEMBL | CHEMBL228127 |
| LOTUS | LTS0139810 |
| wikiData | Q104970315 |