2-[(3,4-Dimethoxyphenyl)methyl]-2,6-dimethoxy-1-benzofuran-3-one
| Internal ID | af9cbc1b-d1d7-4881-b6b5-36538e9a6abc |
| Taxonomy | Phenylpropanoids and polyketides > Aurone flavonoids |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-2,6-dimethoxy-1-benzofuran-3-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C(=O)C(O2)(CC3=CC(=C(C=C3)OC)OC)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C(=O)C(O2)(CC3=CC(=C(C=C3)OC)OC)OC |
| InChI | InChI=1S/C19H20O6/c1-21-13-6-7-14-16(10-13)25-19(24-4,18(14)20)11-12-5-8-15(22-2)17(9-12)23-3/h5-10H,11H2,1-4H3 |
| InChI Key | ZRNOFYYWQGYQHG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 63.20 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
![2D Structure of 2-[(3,4-Dimethoxyphenyl)methyl]-2,6-dimethoxy-1-benzofuran-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-34-dimethoxyphenylmethyl-26-dimethoxy-1-benzofuran-3-one.jpg "2D Structure of 2-[(3,4-Dimethoxyphenyl)methyl]-2,6-dimethoxy-1-benzofuran-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.63% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.48% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.39% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.91% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.30% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.17% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.16% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.01% | 93.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.86% | 95.89% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 87.50% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.54% | 90.20% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.24% | 86.92% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.53% | 98.75% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 83.32% | 95.12% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.15% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.12% | 92.62% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.06% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Umtiza listeriana |
| PubChem | 15555857 |
| LOTUS | LTS0239117 |
| wikiData | Q105382100 |