2-(3,4-Dimethoxyphenyl)-7-methoxy-3-methyl-5-prop-1-enyl-1-benzofuran
Internal ID | f4364dc8-df03-4ce6-b53c-0cc05e21bc60 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-5-prop-1-enyl-1-benzofuran |
SMILES (Canonical) | CC=CC1=CC2=C(C(=C1)OC)OC(=C2C)C3=CC(=C(C=C3)OC)OC |
SMILES (Isomeric) | CC=CC1=CC2=C(C(=C1)OC)OC(=C2C)C3=CC(=C(C=C3)OC)OC |
InChI | InChI=1S/C21H22O4/c1-6-7-14-10-16-13(2)20(25-21(16)19(11-14)24-5)15-8-9-17(22-3)18(12-15)23-4/h6-12H,1-5H3 |
InChI Key | LXRVZJFJYYQBCU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O4 |
Molecular Weight | 338.40 g/mol |
Exact Mass | 338.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 40.80 Ų |
XlogP | 5.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.50% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.78% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.01% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.56% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.74% | 97.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.05% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.89% | 92.94% |
CHEMBL5747 | Q92793 | CREB-binding protein | 86.61% | 95.12% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.65% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.60% | 93.31% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 82.76% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.40% | 95.89% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.25% | 83.10% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.02% | 92.86% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.99% | 91.11% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.80% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eupomatia laurina |
PubChem | 71437667 |
LOTUS | LTS0189304 |
wikiData | Q105159048 |