2-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine
| Internal ID | 482e6d56-3a6a-458e-825b-7379ebbe0006 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2CN3CCCCC3CC2C4=CC(=C(C=C4)OC)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2CN3CCCCC3CC2C4=CC(=C(C=C4)OC)OC |
| InChI | InChI=1S/C24H31NO3/c1-26-20-10-7-17(8-11-20)22-16-25-13-5-4-6-19(25)15-21(22)18-9-12-23(27-2)24(14-18)28-3/h7-12,14,19,21-22H,4-6,13,15-16H2,1-3H3 |
| InChI Key | GMQYKWXEHFKAJW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.23039385 g/mol |
| Topological Polar Surface Area (TPSA) | 30.90 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.75% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.95% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.79% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.71% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.74% | 95.89% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 92.17% | 88.48% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.97% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.22% | 95.56% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 90.17% | 99.18% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.11% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.92% | 90.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 88.58% | 95.12% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 88.57% | 97.53% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 86.62% | 91.43% |
| CHEMBL2337 | P48067 | Glycine transporter 1 | 86.47% | 95.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.33% | 85.14% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 85.53% | 95.61% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.34% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.84% | 97.14% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.61% | 90.95% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.43% | 94.78% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.11% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.82% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.22% | 96.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.63% | 91.03% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.01% | 86.92% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 80.48% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cissus rheifolia |
| PubChem | 73744579 |
| LOTUS | LTS0086212 |
| wikiData | Q105012103 |