2-(3,4-Dihydroxyphenyl)-7-hydroxy-5-methoxy-2,3-dihydrochromen-4-one
Internal ID | 9f03ff2d-3291-4c89-b0ab-456b7b3678a7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=CC2=C1C(=O)CC(O2)C3=CC(=C(C=C3)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1C(=O)CC(O2)C3=CC(=C(C=C3)O)O)O |
InChI | InChI=1S/C16H14O6/c1-21-14-5-9(17)6-15-16(14)12(20)7-13(22-15)8-2-3-10(18)11(19)4-8/h2-6,13,17-19H,7H2,1H3 |
InChI Key | RMJKSMSYIZHFCO-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H14O6 |
Molecular Weight | 302.28 g/mol |
Exact Mass | 302.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 1.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.79% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.84% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.18% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.61% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.29% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.11% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.10% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.03% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.74% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.62% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 88.42% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.15% | 99.15% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.08% | 83.82% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.47% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 86.34% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.62% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.48% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 83.34% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.24% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.54% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Genista corsica |
Iva frutescens |
Onychium japonicum |
PubChem | 17841897 |
LOTUS | LTS0196310 |
wikiData | Q105240814 |