2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one
Internal ID | ec18245f-42ef-4f4b-8ab7-f3becb9a471d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 8-prenylated flavones |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)CC=C(C)C)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)CC=C(C)C)O)C |
InChI | InChI=1S/C25H26O6/c1-13(2)5-8-16-23(29)17(9-6-14(3)4)25-22(24(16)30)20(28)12-21(31-25)15-7-10-18(26)19(27)11-15/h5-7,10-12,26-27,29-30H,8-9H2,1-4H3 |
InChI Key | KNYNUVZHFAMLDT-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H26O6 |
Molecular Weight | 422.50 g/mol |
Exact Mass | 422.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 6.20 |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methyl-2-butenyl)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.81% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.02% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.11% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.37% | 89.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.77% | 89.34% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.46% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.39% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.52% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.15% | 86.33% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.11% | 98.11% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.18% | 85.30% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.15% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.19% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.63% | 96.95% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.51% | 97.28% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.74% | 91.71% |
CHEMBL3194 | P02766 | Transthyretin | 83.58% | 90.71% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.37% | 83.10% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.30% | 86.92% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.59% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Derris laxiflora |
Dorstenia mannii |
Monotes engleri |
Vellozia nanuzae |
PubChem | 10669924 |
LOTUS | LTS0051373 |
wikiData | Q104403468 |