2-(3,4-Dihydroxyphenyl)-5-hydroxy-3-methoxy-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one
Internal ID | 1f5d16db-3c76-4860-bbf4-d3b4bcee6bb6 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3-methoxy-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC)C4=CC(=C(C=C4)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC)C4=CC(=C(C=C4)O)O)O)O)O)O |
InChI | InChI=1S/C22H22O11/c1-8-16(26)18(28)19(29)22(31-8)32-10-6-13(25)15-14(7-10)33-20(21(30-2)17(15)27)9-3-4-11(23)12(24)5-9/h3-8,16,18-19,22-26,28-29H,1-2H3 |
InChI Key | LZFDWQPXTCYLAG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.77% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.70% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.10% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.00% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.44% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.36% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.59% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.49% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.91% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.44% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.45% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.85% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.94% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.43% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.06% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 81.94% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.47% | 95.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.39% | 97.09% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.03% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dacrycarpus dacrydioides |
PubChem | 74978415 |
LOTUS | LTS0205577 |
wikiData | Q105159836 |