2-(3'-Hydroxy,4'-methoxyphenylethyl)-4-methoxyquinoline
Internal ID | 4a07ebe4-f189-4ae7-9557-c071ca9f832a |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives |
IUPAC Name | 2-methoxy-5-[2-(4-methoxyquinolin-2-yl)ethyl]phenol |
SMILES (Canonical) | COC1=C(C=C(C=C1)CCC2=NC3=CC=CC=C3C(=C2)OC)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)CCC2=NC3=CC=CC=C3C(=C2)OC)O |
InChI | InChI=1S/C19H19NO3/c1-22-18-10-8-13(11-17(18)21)7-9-14-12-19(23-2)15-5-3-4-6-16(15)20-14/h3-6,8,10-12,21H,7,9H2,1-2H3 |
InChI Key | UIVNIUPIHQVAQN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H19NO3 |
Molecular Weight | 309.40 g/mol |
Exact Mass | 309.13649347 g/mol |
Topological Polar Surface Area (TPSA) | 51.60 Ų |
XlogP | 4.30 |
2-(3'-hydroxy,4'-methoxyphenylethyl)-4-methoxyquinoline |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.12% | 86.33% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 95.98% | 90.20% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.97% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.61% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.74% | 94.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.87% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.58% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.58% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 90.20% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.68% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.95% | 92.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.87% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.20% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.48% | 99.15% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.63% | 96.25% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.91% | 92.67% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.73% | 94.03% |
CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 80.53% | 87.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angostura trifoliata |
PubChem | 91749528 |
LOTUS | LTS0216797 |
wikiData | Q105273626 |