2-(3-Bromo-4-chloro-4-methylcyclohexyl)-2,6,6-trimethylpyran-3-one
| Internal ID | 56eec7d9-d203-4a8c-bccf-9e9f82418b59 |
| Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives > Dihydropyranones |
| IUPAC Name | 2-(3-bromo-4-chloro-4-methylcyclohexyl)-2,6,6-trimethylpyran-3-one |
| SMILES (Canonical) | CC1(C=CC(=O)C(O1)(C)C2CCC(C(C2)Br)(C)Cl)C |
| SMILES (Isomeric) | CC1(C=CC(=O)C(O1)(C)C2CCC(C(C2)Br)(C)Cl)C |
| InChI | InChI=1S/C15H22BrClO2/c1-13(2)7-6-12(18)15(4,19-13)10-5-8-14(3,17)11(16)9-10/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChI Key | PXPRNVNJRBIVSF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22BrClO2 |
| Molecular Weight | 349.69 g/mol |
| Exact Mass | 348.04917 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.43% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.43% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.02% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.01% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.83% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.73% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.45% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.28% | 96.43% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.40% | 96.77% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.68% | 97.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.62% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.52% | 95.56% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.46% | 85.30% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 81.76% | 88.84% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.25% | 94.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.58% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Porella caespitans |
| Porella grandiloba |
| Porella subobtusa |
| Porella swartziana |
| PubChem | 14314416 |
| LOTUS | LTS0090680 |
| wikiData | Q104399522 |