[2-(3-Acetyloxyprop-1-en-2-yl)-4-methoxy-5-methylphenyl] 2-methylpropanoate
Internal ID | 33d0b75f-95e2-47ad-aa73-78e2dbc31db6 |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | [2-(3-acetyloxyprop-1-en-2-yl)-4-methoxy-5-methylphenyl] 2-methylpropanoate |
SMILES (Canonical) | CC1=CC(=C(C=C1OC)C(=C)COC(=O)C)OC(=O)C(C)C |
SMILES (Isomeric) | CC1=CC(=C(C=C1OC)C(=C)COC(=O)C)OC(=O)C(C)C |
InChI | InChI=1S/C17H22O5/c1-10(2)17(19)22-16-7-11(3)15(20-6)8-14(16)12(4)9-21-13(5)18/h7-8,10H,4,9H2,1-3,5-6H3 |
InChI Key | DHHGGSJGACOCPQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H22O5 |
Molecular Weight | 306.40 g/mol |
Exact Mass | 306.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 3.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.04% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.35% | 91.11% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.54% | 97.21% |
CHEMBL2581 | P07339 | Cathepsin D | 93.04% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.25% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.50% | 95.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.42% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.91% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.87% | 94.73% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.28% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 87.21% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.11% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.02% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.73% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.78% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.70% | 97.36% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.03% | 94.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.78% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mikania decora |
Schizogyne glaberrima |
PubChem | 162893437 |
LOTUS | LTS0122470 |
wikiData | Q104980071 |