2-[3-[4,5-Dihydroxy-6-(2-phenylethenyl)oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one
| Internal ID | de266d6a-6e3a-4857-892a-4be2574cd1a0 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > C-glycosyl compounds |
| IUPAC Name | 2-[3-[4,5-dihydroxy-6-(2-phenylethenyl)oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
| SMILES (Canonical) | C1C=CC(=O)OC1C=CCC2CC(C(C(O2)C=CC3=CC=CC=C3)O)O |
| SMILES (Isomeric) | C1C=CC(=O)OC1C=CCC2CC(C(C(O2)C=CC3=CC=CC=C3)O)O |
| InChI | InChI=1S/C21H24O5/c22-18-14-17(10-4-8-16-9-5-11-20(23)26-16)25-19(21(18)24)13-12-15-6-2-1-3-7-15/h1-8,11-13,16-19,21-22,24H,9-10,14H2 |
| InChI Key | ITOWMYXEGADZIR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of 2-[3-[4,5-Dihydroxy-6-(2-phenylethenyl)oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-3-45-dihydroxy-6-2-phenylethenyloxan-2-ylprop-1-enyl-23-dihydropyran-6-one.jpg "2D Structure of 2-[3-[4,5-Dihydroxy-6-(2-phenylethenyl)oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.04% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.64% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.12% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.14% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.78% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.98% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.84% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.39% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.90% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.71% | 94.73% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.99% | 90.24% |
| CHEMBL5028 | O14672 | ADAM10 | 80.19% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptocarya moschata |
| PubChem | 75577262 |
| LOTUS | LTS0190992 |
| wikiData | Q104169114 |