2-[3-(3,7-Dimethylocta-2,6-dienyl)-4-hydroxyphenyl]-5,7-dihydroxy-6-methyl-2,3-dihydrochromen-4-one
Internal ID | 86ac5fb5-7c36-4363-9dfd-3b7a5dd4be1f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 3-prenylated flavans > 3-prenylated flavanones |
IUPAC Name | 2-[3-(3,7-dimethylocta-2,6-dienyl)-4-hydroxyphenyl]-5,7-dihydroxy-6-methyl-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1=C(C2=C(C=C1O)OC(CC2=O)C3=CC(=C(C=C3)O)CC=C(C)CCC=C(C)C)O |
SMILES (Isomeric) | CC1=C(C2=C(C=C1O)OC(CC2=O)C3=CC(=C(C=C3)O)CC=C(C)CCC=C(C)C)O |
InChI | InChI=1S/C26H30O5/c1-15(2)6-5-7-16(3)8-9-18-12-19(10-11-20(18)27)23-14-22(29)25-24(31-23)13-21(28)17(4)26(25)30/h6,8,10-13,23,27-28,30H,5,7,9,14H2,1-4H3 |
InChI Key | RILNWSNLVSDZNW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H30O5 |
Molecular Weight | 422.50 g/mol |
Exact Mass | 422.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 6.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.87% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.40% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.05% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.99% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.34% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.82% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.49% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.25% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.76% | 99.15% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.48% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.78% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.68% | 100.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.34% | 92.68% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.41% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.80% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.34% | 99.17% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.09% | 92.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.85% | 96.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.12% | 96.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campylotropis hirtella |
PubChem | 74073036 |
LOTUS | LTS0160963 |
wikiData | Q105236950 |