2-[3-[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one
Internal ID | 6412c534-aad1-41cc-a3eb-db669ec629ab |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 2-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC(=C1)OC2C(C(C(C(O2)CO)O)O)O)C3=CC(=O)C4=C(O3)C5=C(C=C4)OC=C5 |
SMILES (Isomeric) | C1=CC(=CC(=C1)OC2C(C(C(C(O2)CO)O)O)O)C3=CC(=O)C4=C(O3)C5=C(C=C4)OC=C5 |
InChI | InChI=1S/C23H20O9/c24-10-18-19(26)20(27)21(28)23(32-18)30-12-3-1-2-11(8-12)17-9-15(25)13-4-5-16-14(6-7-29-16)22(13)31-17/h1-9,18-21,23-24,26-28H,10H2 |
InChI Key | DJCDSGSDGQRCIB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H20O9 |
Molecular Weight | 440.40 g/mol |
Exact Mass | 440.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 139.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of 2-[3-[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one 2D Structure of 2-[3-[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-3-345-trihydroxy-6-hydroxymethyloxan-2-yloxyphenylfuro23-hchromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.34% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.06% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.76% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.32% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.84% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 91.63% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.49% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.89% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.97% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.79% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.31% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.30% | 94.45% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.13% | 95.83% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.76% | 99.23% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.37% | 94.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.44% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.56% | 86.92% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.31% | 97.53% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.00% | 99.15% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.60% | 92.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pongamia pinnata |
PubChem | 74977402 |
LOTUS | LTS0136262 |
wikiData | Q104981951 |