2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide
Internal ID | 0c49bd30-5dbb-47d4-8f2f-f4fe8292b544 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides > Aromatic anilides > Benzanilides |
IUPAC Name | 2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide |
SMILES (Canonical) | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)F)NC(=O)C3=CC(=CC=C3)NS(=O)(=O)C4=CC(=C(C=C4)F)F |
SMILES (Isomeric) | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)F)NC(=O)C3=CC(=CC=C3)NS(=O)(=O)C4=CC(=C(C=C4)F)F |
InChI | InChI=1S/C26H18F3N3O4S/c27-17-8-10-18(11-9-17)30-26(34)21-6-1-2-7-24(21)31-25(33)16-4-3-5-19(14-16)32-37(35,36)20-12-13-22(28)23(29)15-20/h1-15,32H,(H,30,34)(H,31,33) |
InChI Key | UQUXMBDAOCUYHF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H18F3N3O4S |
Molecular Weight | 525.50 g/mol |
Exact Mass | 525.09701172 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 5.00 |
Atomic LogP (AlogP) | 5.41 |
H-Bond Acceptor | 4 |
H-Bond Donor | 3 |
Rotatable Bonds | 7 |
Z56872605 |
![2D Structure of 2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide 2D Structure of 2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/2-3-34-difluorophenylsulfonylaminobenzoylamino-n-4-fluorophenylbenzamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7118 | 71.18% |
Caco-2 | - | 0.7958 | 79.58% |
Blood Brain Barrier | + | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.7502 | 75.02% |
OATP2B1 inhibitior | - | 0.7129 | 71.29% |
OATP1B1 inhibitior | + | 0.9282 | 92.82% |
OATP1B3 inhibitior | + | 0.9451 | 94.51% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | + | 0.9204 | 92.04% |
P-glycoprotein inhibitior | + | 0.6782 | 67.82% |
P-glycoprotein substrate | - | 0.5754 | 57.54% |
CYP3A4 substrate | + | 0.5109 | 51.09% |
CYP2C9 substrate | - | 0.8000 | 80.00% |
CYP2D6 substrate | - | 0.8757 | 87.57% |
CYP3A4 inhibition | - | 0.6093 | 60.93% |
CYP2C9 inhibition | - | 0.6855 | 68.55% |
CYP2C19 inhibition | - | 0.6657 | 66.57% |
CYP2D6 inhibition | - | 0.8810 | 88.10% |
CYP1A2 inhibition | - | 0.7510 | 75.10% |
CYP2C8 inhibition | + | 0.8577 | 85.77% |
CYP inhibitory promiscuity | + | 0.6877 | 68.77% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.5419 | 54.19% |
Carcinogenicity (trinary) | Non-required | 0.6104 | 61.04% |
Eye corrosion | - | 0.9801 | 98.01% |
Eye irritation | - | 0.9138 | 91.38% |
Skin irritation | - | 0.8616 | 86.16% |
Skin corrosion | - | 0.9715 | 97.15% |
Ames mutagenesis | - | 0.6300 | 63.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7099 | 70.99% |
Micronuclear | + | 0.9300 | 93.00% |
Hepatotoxicity | + | 0.6750 | 67.50% |
skin sensitisation | - | 0.8898 | 88.98% |
Respiratory toxicity | + | 0.6333 | 63.33% |
Reproductive toxicity | - | 0.7222 | 72.22% |
Mitochondrial toxicity | + | 0.6250 | 62.50% |
Nephrotoxicity | + | 0.8058 | 80.58% |
Acute Oral Toxicity (c) | III | 0.6878 | 68.78% |
Estrogen receptor binding | + | 0.6822 | 68.22% |
Androgen receptor binding | + | 0.6424 | 64.24% |
Thyroid receptor binding | + | 0.6470 | 64.70% |
Glucocorticoid receptor binding | + | 0.6820 | 68.20% |
Aromatase binding | - | 0.5866 | 58.66% |
PPAR gamma | + | 0.7236 | 72.36% |
Honey bee toxicity | - | 0.9190 | 91.90% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 1.0000 | 100.00% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 99.61% | 96.38% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 99.30% | 81.11% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 99.10% | 87.67% |
CHEMBL240 | Q12809 | HERG | 98.21% | 89.76% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.09% | 95.56% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 98.00% | 98.75% |
CHEMBL2535 | P11166 | Glucose transporter | 97.54% | 98.75% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 97.19% | 93.03% |
CHEMBL2409 | P34913 | Epoxide hydratase | 96.33% | 94.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.86% | 94.73% |
CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 94.57% | 94.67% |
CHEMBL1952 | P04818 | Thymidylate synthase | 94.31% | 93.53% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.26% | 97.36% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.24% | 99.23% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.70% | 91.24% |
CHEMBL4531 | P17931 | Galectin-3 | 90.70% | 96.90% |
CHEMBL2104 | Q99571 | P2X purinoceptor 4 | 90.31% | 97.50% |
CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 90.22% | 80.00% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 90.05% | 97.53% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 89.42% | 93.81% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.13% | 94.33% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.05% | 91.38% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.79% | 97.21% |
CHEMBL3180 | O00748 | Carboxylesterase 2 | 87.61% | 90.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.53% | 90.20% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 86.22% | 91.65% |
CHEMBL4973 | P43004 | Excitatory amino acid transporter 2 | 86.15% | 98.75% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.02% | 86.92% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 85.98% | 95.48% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.79% | 91.19% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 85.01% | 96.00% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 84.50% | 95.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.26% | 96.00% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 84.15% | 87.16% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.39% | 89.44% |
CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 83.30% | 90.75% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.77% | 85.83% |
CHEMBL2216739 | Q92523 | Carnitine O-palmitoyltransferase 1, muscle isoform | 82.18% | 88.33% |
CHEMBL2721 | P43005 | Excitatory amino acid transporter 3 | 82.14% | 93.50% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.25% | 82.69% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.02% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.48% | 94.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.30% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phlomis aurea |
PubChem | 2421196 |
LOTUS | LTS0267817 |
wikiData | Q105277465 |