2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide
| Internal ID | 0c49bd30-5dbb-47d4-8f2f-f4fe8292b544 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides > Aromatic anilides > Benzanilides |
| IUPAC Name | 2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide |
| SMILES (Canonical) | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)F)NC(=O)C3=CC(=CC=C3)NS(=O)(=O)C4=CC(=C(C=C4)F)F |
| SMILES (Isomeric) | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)F)NC(=O)C3=CC(=CC=C3)NS(=O)(=O)C4=CC(=C(C=C4)F)F |
| InChI | InChI=1S/C26H18F3N3O4S/c27-17-8-10-18(11-9-17)30-26(34)21-6-1-2-7-24(21)31-25(33)16-4-3-5-19(14-16)32-37(35,36)20-12-13-22(28)23(29)15-20/h1-15,32H,(H,30,34)(H,31,33) |
| InChI Key | UQUXMBDAOCUYHF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H18F3N3O4S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.09701172 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 5.00 |
| Z56872605 |
![2D Structure of 2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/2-3-34-difluorophenylsulfonylaminobenzoylamino-n-4-fluorophenylbenzamide.jpg "2D Structure of 2-[[3-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-N-(4-fluorophenyl)benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 99.61% | 96.38% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 99.30% | 81.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 99.10% | 87.67% |
| CHEMBL240 | Q12809 | HERG | 98.21% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.09% | 95.56% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 98.00% | 98.75% |
| CHEMBL2535 | P11166 | Glucose transporter | 97.54% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 97.19% | 93.03% |
| CHEMBL2409 | P34913 | Epoxide hydratase | 96.33% | 94.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.86% | 94.73% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 94.57% | 94.67% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 94.31% | 93.53% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.26% | 97.36% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.24% | 99.23% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.70% | 91.24% |
| CHEMBL4531 | P17931 | Galectin-3 | 90.70% | 96.90% |
| CHEMBL2104 | Q99571 | P2X purinoceptor 4 | 90.31% | 97.50% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 90.22% | 80.00% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 90.05% | 97.53% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 89.42% | 93.81% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.13% | 94.33% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.05% | 91.38% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.79% | 97.21% |
| CHEMBL3180 | O00748 | Carboxylesterase 2 | 87.61% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.53% | 90.20% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 86.22% | 91.65% |
| CHEMBL4973 | P43004 | Excitatory amino acid transporter 2 | 86.15% | 98.75% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.02% | 86.92% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 85.98% | 95.48% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.79% | 91.19% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 85.01% | 96.00% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 84.50% | 95.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.26% | 96.00% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 84.15% | 87.16% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.39% | 89.44% |
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 83.30% | 90.75% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.77% | 85.83% |
| CHEMBL2216739 | Q92523 | Carnitine O-palmitoyltransferase 1, muscle isoform | 82.18% | 88.33% |
| CHEMBL2721 | P43005 | Excitatory amino acid transporter 3 | 82.14% | 93.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.25% | 82.69% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.02% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.48% | 94.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.30% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phlomis aurea |
| PubChem | 2421196 |
| LOTUS | LTS0267817 |
| wikiData | Q105277465 |