2-(3-(2-((1H-Imidazol-2-yl)methyl)-6-methoxyphenoxy)benzyl)-1H-imidazole
| Internal ID | 5a742f7f-f867-4921-9df9-e1dcb33af9bc |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylethers |
| IUPAC Name | 2-[[3-[2-(1H-imidazol-2-ylmethyl)-6-methoxyphenoxy]phenyl]methyl]-1H-imidazole |
| SMILES (Canonical) | COC1=CC=CC(=C1OC2=CC=CC(=C2)CC3=NC=CN3)CC4=NC=CN4 |
| SMILES (Isomeric) | COC1=CC=CC(=C1OC2=CC=CC(=C2)CC3=NC=CN3)CC4=NC=CN4 |
| InChI | InChI=1S/C21H20N4O2/c1-26-18-7-3-5-16(14-20-24-10-11-25-20)21(18)27-17-6-2-4-15(12-17)13-19-22-8-9-23-19/h2-12H,13-14H2,1H3,(H,22,23)(H,24,25) |
| InChI Key | YDQJXVYGARVLRT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15862589 g/mol |
| Topological Polar Surface Area (TPSA) | 75.80 Ų |
| XlogP | 3.60 |
| 2-(3-(2-((1H-Imidazol-2-yl)methyl)-6-methoxyphenoxy)benzyl)-1H-imidazole |
| laquo gammaRaquo -methylquinoline |
| DTXSID101138201 |
| 2-[[3-[2-(1H-Imidazol-2-ylmethyl)-6-methoxyphenoxy]phenyl]methyl]-1H-imidazole |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 98.97% | 95.39% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.16% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.74% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.68% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.66% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.22% | 93.99% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 92.03% | 94.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.43% | 98.95% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.24% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.71% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.11% | 94.73% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.46% | 99.18% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.22% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.80% | 95.89% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.32% | 100.00% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 82.70% | 87.50% |
| CHEMBL2319 | P06870 | Kallikrein 1 | 82.53% | 90.95% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.16% | 92.98% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.40% | 92.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.28% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.55% | 96.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.42% | 93.18% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 80.25% | 96.47% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.17% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lepidium sativum |
| PubChem | 131751423 |
| LOTUS | LTS0161529 |
| wikiData | Q105346915 |