2-[[(2S,4S)-4,5-diamino-2-hydroxypentanoyl]amino]-4-methylpentanamide
| Internal ID | 9aa14824-5be1-433f-aebe-d0267a70d49e |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Amines > Alkanolamines > 1,3-aminoalcohols |
| IUPAC Name | 2-[[(2S,4S)-4,5-diamino-2-hydroxypentanoyl]amino]-4-methylpentanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H24N4O3/c1-6(2)3-8(10(14)17)15-11(18)9(16)4-7(13)5-12/h6-9,16H,3-5,12-13H2,1-2H3,(H2,14,17)(H,15,18)/t7-,8?,9-/m0/s1 |
| InChI Key | VTJRQLJOIUWHBZ-SMOXQLQSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.18484064 g/mol |
| Topological Polar Surface Area (TPSA) | 144.00 Ų |
| XlogP | -1.90 |
| There are no found synonyms. |
![2D Structure of 2-[[(2S,4S)-4,5-diamino-2-hydroxypentanoyl]amino]-4-methylpentanamide](https://plantaedb.com/storage/docs/compounds/2023/11/2-2s4s-45-diamino-2-hydroxypentanoylamino-4-methylpentanamide.jpg "2D Structure of 2-[[(2S,4S)-4,5-diamino-2-hydroxypentanoyl]amino]-4-methylpentanamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.22% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.00% | 90.17% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.78% | 98.05% |
| CHEMBL3837 | P07711 | Cathepsin L | 93.63% | 96.61% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.89% | 85.14% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.74% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.36% | 83.82% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.33% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.20% | 96.47% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 87.84% | 96.28% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 87.65% | 83.10% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.81% | 96.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.96% | 92.29% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.68% | 87.45% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 85.20% | 96.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.39% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.68% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.42% | 90.20% |
| CHEMBL3308 | P55212 | Caspase-6 | 83.38% | 97.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.33% | 97.21% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.33% | 95.71% |
| CHEMBL1801 | P00747 | Plasminogen | 83.20% | 92.44% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.94% | 94.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.91% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.88% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.87% | 97.29% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.38% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.21% | 90.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.61% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162863616 |
| LOTUS | LTS0053466 |
| wikiData | Q105292781 |