2-[(2S)-5-(3-hydroxyprop-1-enyl)-2,3-dihydro-1-benzofuran-2-yl]propan-2-ol
| Internal ID | 25c7281d-3dbf-4c47-b610-462774f2c69d |
| Taxonomy | Organoheterocyclic compounds > Coumarans |
| IUPAC Name | 2-[(2S)-5-(3-hydroxyprop-1-enyl)-2,3-dihydro-1-benzofuran-2-yl]propan-2-ol |
| SMILES (Canonical) | CC(C)(C1CC2=C(O1)C=CC(=C2)C=CCO)O |
| SMILES (Isomeric) | CC(C)([C@@H]1CC2=C(O1)C=CC(=C2)C=CCO)O |
| InChI | InChI=1S/C14H18O3/c1-14(2,16)13-9-11-8-10(4-3-7-15)5-6-12(11)17-13/h3-6,8,13,15-16H,7,9H2,1-2H3/t13-/m0/s1 |
| InChI Key | URAVGAVOMPKTLI-ZDUSSCGKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of 2-[(2S)-5-(3-hydroxyprop-1-enyl)-2,3-dihydro-1-benzofuran-2-yl]propan-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2-2s-5-3-hydroxyprop-1-enyl-23-dihydro-1-benzofuran-2-ylpropan-2-ol.jpg "2D Structure of 2-[(2S)-5-(3-hydroxyprop-1-enyl)-2,3-dihydro-1-benzofuran-2-yl]propan-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.27% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.64% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.02% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.31% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.91% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.65% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.51% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.41% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.12% | 99.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.54% | 100.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.08% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.96% | 97.09% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.20% | 100.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.09% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum wutaiense |
| PubChem | 162946573 |
| LOTUS | LTS0093760 |
| wikiData | Q105277595 |