[2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate
Internal ID | d4fdd909-8569-4ac5-9cde-bd917eddb1c6 |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1=C(C=C(C=C1)OC(=O)C(C)C)C2C(O2)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)OC1=C(C=C(C=C1)OC(=O)C(C)C)[C@@H]2[C@H](O2)C |
InChI | InChI=1S/C18H22O5/c1-6-11(4)18(20)23-15-8-7-13(22-17(19)10(2)3)9-14(15)16-12(5)21-16/h6-10,12,16H,1-5H3/b11-6-/t12-,16+/m1/s1 |
InChI Key | FOVBSXKQAYLJKF-CLYSGXADSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H22O5 |
Molecular Weight | 318.40 g/mol |
Exact Mass | 318.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate 2D Structure of [2-[(2R,3R)-3-methyloxiran-2-yl]-4-(2-methylpropanoyloxy)phenyl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/2-2r3r-3-methyloxiran-2-yl-4-2-methylpropanoyloxyphenyl-z-2-methylbut-2-enoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.20% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.78% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.09% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.95% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 90.37% | 98.95% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 89.69% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.56% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.52% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.51% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.49% | 91.07% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.20% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.09% | 90.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.37% | 97.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.30% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.29% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pimpinella diversifolia |
PubChem | 163188798 |
LOTUS | LTS0081555 |
wikiData | Q104998973 |