2-[(2R)-7,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-ol
| Internal ID | 87322822-fb37-4d03-8bf2-3d4e8d64d865 |
| Taxonomy | Benzenoids > Tetralins |
| IUPAC Name | 2-[(2R)-7,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-ol |
| SMILES (Canonical) | CC1=C(C2=C(CCC(C2)C(C)(C)O)C=C1)C |
| SMILES (Isomeric) | CC1=C(C2=C(CC[C@H](C2)C(C)(C)O)C=C1)C |
| InChI | InChI=1S/C15H22O/c1-10-5-6-12-7-8-13(15(3,4)16)9-14(12)11(10)2/h5-6,13,16H,7-9H2,1-4H3/t13-/m1/s1 |
| InChI Key | MXWNBEGGJOONGS-CYBMUJFWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.167065321 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 2-[(2R)-7,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2-2r-78-dimethyl-1234-tetrahydronaphthalen-2-ylpropan-2-ol.jpg "2D Structure of 2-[(2R)-7,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 93.40% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.77% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.43% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.99% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.71% | 93.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.40% | 93.65% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.97% | 95.89% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.48% | 93.04% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.26% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.07% | 97.25% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.69% | 95.62% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.52% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.33% | 97.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.26% | 100.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.02% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana rustica |
| Nicotiana undulata |
| PubChem | 15601433 |
| LOTUS | LTS0231150 |
| wikiData | Q105174642 |