2-[(2R)-5,6-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-ol
Internal ID | 39f6a9e2-516d-44bd-b8f6-5f81040e9787 |
Taxonomy | Benzenoids > Tetralins |
IUPAC Name | 2-[(2R)-5,6-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-ol |
SMILES (Canonical) | CC1=C(C2=C(CC(CC2)C(C)(C)O)C=C1)C |
SMILES (Isomeric) | CC1=C(C2=C(C[C@@H](CC2)C(C)(C)O)C=C1)C |
InChI | InChI=1S/C15H22O/c1-10-5-6-12-9-13(15(3,4)16)7-8-14(12)11(10)2/h5-6,13,16H,7-9H2,1-4H3/t13-/m1/s1 |
InChI Key | PVLXCCNONOJBBX-CYBMUJFWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22O |
Molecular Weight | 218.33 g/mol |
Exact Mass | 218.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 3.50 |
87797-89-5 |
(2R)-1,2,3,4-Tetrahydro-alpha,alpha,5,6-tetramethyl-2-naphthalenemethanol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.53% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 93.67% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.32% | 91.11% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.98% | 93.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 89.71% | 95.62% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.42% | 93.65% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.38% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.03% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.49% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.12% | 93.04% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.85% | 93.40% |
CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 82.66% | 94.05% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.24% | 97.25% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 81.58% | 83.14% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.93% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.04% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.01% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana rustica |
Nicotiana undulata |
PubChem | 15601435 |
LOTUS | LTS0192779 |
wikiData | Q105215510 |