2-[(2R)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-5-(3-hydroxypropyl)phenol
| Internal ID | 3de50d1a-9685-4334-9228-db4968d83e2d |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | 2-[(2R)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-5-(3-hydroxypropyl)phenol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)CC(CO)OC2=C(C=C(C=C2)CCCO)O)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)C[C@H](CO)OC2=C(C=C(C=C2)CCCO)O)O |
| InChI | InChI=1S/C19H24O6/c1-24-19-11-14(4-6-16(19)22)9-15(12-21)25-18-7-5-13(3-2-8-20)10-17(18)23/h4-7,10-11,15,20-23H,2-3,8-9,12H2,1H3/t15-/m1/s1 |
| InChI Key | PGLMLQXSCSFXOP-OAHLLOKOSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.15% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.89% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.36% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.45% | 95.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.29% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.81% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.18% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.44% | 91.49% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.33% | 86.92% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.87% | 98.75% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.42% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.91% | 90.24% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.90% | 96.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.25% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.00% | 95.89% |
| CHEMBL3194 | P02766 | Transthyretin | 82.94% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.85% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.23% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Juniperus chinensis |
| PubChem | 163050655 |
| LOTUS | LTS0053532 |
| wikiData | Q105208478 |