[2-(2,5-Dihydroxy-4-methylphenyl)-2-hydroxy-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate
| Internal ID | 7fcbf54e-f221-4c92-99d7-c6fec5bcf146 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
| IUPAC Name | [2-(2,5-dihydroxy-4-methylphenyl)-2-hydroxy-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate |
| SMILES (Canonical) | CC1=CC(=C(C=C1O)C(COC(=O)C=CC2=CC=CC=C2)(COC(=O)C(C)C)O)O |
| SMILES (Isomeric) | CC1=CC(=C(C=C1O)C(COC(=O)C=CC2=CC=CC=C2)(COC(=O)C(C)C)O)O |
| InChI | InChI=1S/C23H26O7/c1-15(2)22(27)30-14-23(28,18-12-19(24)16(3)11-20(18)25)13-29-21(26)10-9-17-7-5-4-6-8-17/h4-12,15,24-25,28H,13-14H2,1-3H3 |
| InChI Key | FWIWRIZSUDLYPC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.16785316 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of [2-(2,5-Dihydroxy-4-methylphenyl)-2-hydroxy-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/2-25-dihydroxy-4-methylphenyl-2-hydroxy-3-3-phenylprop-2-enoyloxypropyl-2-methylpropanoate.jpg "2D Structure of [2-(2,5-Dihydroxy-4-methylphenyl)-2-hydroxy-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.75% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.31% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.23% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.18% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.55% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.97% | 99.15% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.51% | 89.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.17% | 96.09% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.93% | 91.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.32% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.19% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.07% | 99.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.57% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.40% | 89.00% |
| CHEMBL5028 | O14672 | ADAM10 | 82.95% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.81% | 95.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.65% | 93.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.42% | 91.49% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.19% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ageratina anisochroma |
| PubChem | 162846937 |
| LOTUS | LTS0057709 |
| wikiData | Q105003304 |