2-(2,3-Dimethoxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one
Internal ID | 8d50fba2-d359-4872-b0a2-890976cf6df2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(2,3-dimethoxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC=CC(=C1OC)C2CC(=O)C3=C(C=C(C=C3O2)OC)O |
SMILES (Isomeric) | COC1=CC=CC(=C1OC)C2CC(=O)C3=C(C=C(C=C3O2)OC)O |
InChI | InChI=1S/C18H18O6/c1-21-10-7-12(19)17-13(20)9-15(24-16(17)8-10)11-5-4-6-14(22-2)18(11)23-3/h4-8,15,19H,9H2,1-3H3 |
InChI Key | PWHHFNGLEOMEAA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H18O6 |
Molecular Weight | 330.30 g/mol |
Exact Mass | 330.11033829 g/mol |
Topological Polar Surface Area (TPSA) | 74.20 Ų |
XlogP | 3.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.19% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.64% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.46% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.29% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 93.71% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.08% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.06% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 91.25% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.56% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.09% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.19% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.63% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.13% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.84% | 93.99% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.23% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.48% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.60% | 92.62% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 81.95% | 89.32% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.06% | 90.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.49% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Andrographis stenophylla |
PubChem | 85087212 |
LOTUS | LTS0109844 |
wikiData | Q105215842 |