2-[(2-Pyridin-3-ylpiperidin-1-yl)methyl]phenol
| Internal ID | 4d20f717-db3b-4455-9e57-b870f8fecf2a |
| Taxonomy | Organoheterocyclic compounds > Piperidines > Benzylpiperidines > N-benzylpiperidines |
| IUPAC Name | 2-[(2-pyridin-3-ylpiperidin-1-yl)methyl]phenol |
| SMILES (Canonical) | C1CCN(C(C1)C2=CN=CC=C2)CC3=CC=CC=C3O |
| SMILES (Isomeric) | C1CCN(C(C1)C2=CN=CC=C2)CC3=CC=CC=C3O |
| InChI | InChI=1S/C17H20N2O/c20-17-9-2-1-6-15(17)13-19-11-4-3-8-16(19)14-7-5-10-18-12-14/h1-2,5-7,9-10,12,16,20H,3-4,8,11,13H2 |
| InChI Key | QKGCWXDVBXIISA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.157563266 g/mol |
| Topological Polar Surface Area (TPSA) | 36.40 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of 2-[(2-Pyridin-3-ylpiperidin-1-yl)methyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-pyridin-3-ylpiperidin-1-ylmethylphenol.jpg "2D Structure of 2-[(2-Pyridin-3-ylpiperidin-1-yl)methyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.25% | 98.95% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 89.14% | 91.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.11% | 97.09% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 88.84% | 91.76% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 86.86% | 91.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.61% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.33% | 86.33% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.90% | 96.25% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.64% | 96.25% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 80.99% | 87.50% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.85% | 96.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.38% | 95.93% |
| CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 80.38% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alangium chinense |
| PubChem | 45928083 |
| LOTUS | LTS0034652 |
| wikiData | Q105223094 |