2-(2-Hydroxypropanamido) benzoic acid
| Internal ID | 06b485b7-61f9-4643-93fd-34835d8e8e45 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Acylaminobenzoic acid and derivatives |
| IUPAC Name | 2-(2-hydroxypropanoylamino)benzoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H11NO4/c1-6(12)9(13)11-8-5-3-2-4-7(8)10(14)15/h2-6,12H,1H3,(H,11,13)(H,14,15) |
| InChI Key | NPBSOOGJABVFSN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.06880783 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 1.60 |
| 2-[[(2S)-2-Hydroxy-1-oxopropyl]amino]benzoic acid |
| 1616065-04-3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.70% | 98.95% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.42% | 87.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.50% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.59% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.32% | 85.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.57% | 90.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.74% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.85% | 95.50% |
| CHEMBL3308 | P55212 | Caspase-6 | 87.04% | 97.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.83% | 99.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.04% | 93.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.49% | 81.11% |
| CHEMBL5847 | P52895 | Aldo-keto reductase family 1 member C2 | 82.01% | 92.50% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 81.87% | 80.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.96% | 100.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.93% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72522970 |
| LOTUS | LTS0090167 |
| wikiData | Q77420753 |