2-[2-(Hydroxymethyl)-3-methoxyphenyl]-7-methyl-1-(3-methylphenyl)benzo[cd]indol-3-one
| Internal ID | 89763797-4acb-4cf9-99b2-d558c607c5ee |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 2-phenylindoles |
| IUPAC Name | 2-[2-(hydroxymethyl)-3-methoxyphenyl]-7-methyl-1-(3-methylphenyl)benzo[cd]indol-3-one |
| SMILES (Canonical) | CC1=CC(=CC=C1)N2C3=CC(=CC4=C3C(=C2C5=C(C(=CC=C5)OC)CO)C(=O)C=C4)C |
| SMILES (Isomeric) | CC1=CC(=CC=C1)N2C3=CC(=CC4=C3C(=C2C5=C(C(=CC=C5)OC)CO)C(=O)C=C4)C |
| InChI | InChI=1S/C27H23NO3/c1-16-6-4-7-19(13-16)28-22-14-17(2)12-18-10-11-23(30)26(25(18)22)27(28)20-8-5-9-24(31-3)21(20)15-29/h4-14,29H,15H2,1-3H3 |
| InChI Key | KZTINOJOKALWSZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 51.50 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.38% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.01% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.06% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.31% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.81% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.82% | 94.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.70% | 96.95% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 91.28% | 96.67% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.61% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.09% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.41% | 98.75% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 87.94% | 96.47% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.57% | 89.62% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.17% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.22% | 96.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.19% | 93.31% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.04% | 82.69% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.41% | 99.17% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 81.77% | 94.05% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.76% | 92.38% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.32% | 91.71% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.17% | 96.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.10% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163144439 |
| LOTUS | LTS0156015 |
| wikiData | Q105148431 |