2-(2-Hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate
Internal ID | e3d01f60-c955-46c1-8bc5-e02fda22e787 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | 2-(2-hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1=CC(=C(C=C1)C(C)COC(=O)C=CC2=CC=CC=C2)O |
SMILES (Isomeric) | CC1=CC(=C(C=C1)C(C)COC(=O)C=CC2=CC=CC=C2)O |
InChI | InChI=1S/C19H20O3/c1-14-8-10-17(18(20)12-14)15(2)13-22-19(21)11-9-16-6-4-3-5-7-16/h3-12,15,20H,13H2,1-2H3 |
InChI Key | HKJXKYNIUODVLN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O3 |
Molecular Weight | 296.40 g/mol |
Exact Mass | 296.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.50 |
There are no found synonyms. |
![2D Structure of 2-(2-Hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate 2D Structure of 2-(2-Hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-hydroxy-4-methylphenylpropyl-3-phenylprop-2-enoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.92% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.99% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.93% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.62% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.30% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.61% | 94.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.77% | 96.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.99% | 91.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.46% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.93% | 99.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.52% | 93.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.98% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.66% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.01% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.16% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ageratina anisochroma |
PubChem | 85571142 |
LOTUS | LTS0042474 |
wikiData | Q105029705 |