2-[2-Hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol
| Internal ID | 3911da94-21a9-4300-9311-22e301c695bf |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol |
| SMILES (Canonical) | COC1=CC=C(C=C1)C(CC2=C(C(=CC=C2)OC)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C(CC2=C(C(=CC=C2)OC)O)O |
| InChI | InChI=1S/C16H18O4/c1-19-13-8-6-11(7-9-13)14(17)10-12-4-3-5-15(20-2)16(12)18/h3-9,14,17-18H,10H2,1-2H3 |
| InChI Key | ZWMBMAHFTDLBAW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 2-[2-Hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-hydroxy-2-4-methoxyphenylethyl-6-methoxyphenol.jpg "2D Structure of 2-[2-Hydroxy-2-(4-methoxyphenyl)ethyl]-6-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.71% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.48% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.03% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.61% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.90% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.63% | 93.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.55% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.79% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.53% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.92% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.20% | 90.20% |
| CHEMBL4422 | O14842 | Free fatty acid receptor 1 | 86.80% | 93.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.54% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.44% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.03% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.07% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.97% | 86.33% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.44% | 93.81% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.79% | 95.89% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.40% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pellia epiphylla |
| Plectranthus parviflorus |
| Plectranthus purpuratus |
| Plectranthus strigosus |
| PubChem | 162980539 |
| LOTUS | LTS0070400 |
| wikiData | Q105282488 |