2-[2-(3-Hydroxyphenyl)ethyl]-4,6-dimethoxyphenol
Internal ID | f212452e-1afe-42a1-ab27-f701124f19ee |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 2-[2-(3-hydroxyphenyl)ethyl]-4,6-dimethoxyphenol |
SMILES (Canonical) | COC1=CC(=C(C(=C1)OC)O)CCC2=CC(=CC=C2)O |
SMILES (Isomeric) | COC1=CC(=C(C(=C1)OC)O)CCC2=CC(=CC=C2)O |
InChI | InChI=1S/C16H18O4/c1-19-14-9-12(16(18)15(10-14)20-2)7-6-11-4-3-5-13(17)8-11/h3-5,8-10,17-18H,6-7H2,1-2H3 |
InChI Key | KFZSPLBNNZKAHQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H18O4 |
Molecular Weight | 274.31 g/mol |
Exact Mass | 274.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of 2-[2-(3-Hydroxyphenyl)ethyl]-4,6-dimethoxyphenol 2D Structure of 2-[2-(3-Hydroxyphenyl)ethyl]-4,6-dimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-3-hydroxyphenylethyl-46-dimethoxyphenol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.70% | 96.09% |
CHEMBL240 | Q12809 | HERG | 96.12% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.99% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.16% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.67% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 91.18% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.63% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.52% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.98% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.91% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.44% | 92.62% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 84.71% | 90.20% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.69% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.57% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.32% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.18% | 95.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.64% | 93.99% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.18% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bulbophyllum protractum |
PubChem | 85711443 |
LOTUS | LTS0122486 |
wikiData | Q105140639 |