2-[2-(3-Formyl-4-hydroxyphenyl)ethenyl]-4,6-dihydroxybenzaldehyde
| Internal ID | aeb1f945-9ba3-485c-920b-a14428471fb0 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 2-[2-(3-formyl-4-hydroxyphenyl)ethenyl]-4,6-dihydroxybenzaldehyde |
| SMILES (Canonical) | C1=CC(=C(C=C1C=CC2=C(C(=CC(=C2)O)O)C=O)C=O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C=CC2=C(C(=CC(=C2)O)O)C=O)C=O)O |
| InChI | InChI=1S/C16H12O5/c17-8-12-5-10(2-4-15(12)20)1-3-11-6-13(19)7-16(21)14(11)9-18/h1-9,19-21H |
| InChI Key | KSVVDMJECFEDLH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 94.80 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 2-[2-(3-Formyl-4-hydroxyphenyl)ethenyl]-4,6-dihydroxybenzaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-3-formyl-4-hydroxyphenylethenyl-46-dihydroxybenzaldehyde.jpg "2D Structure of 2-[2-(3-Formyl-4-hydroxyphenyl)ethenyl]-4,6-dihydroxybenzaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 99.28% | 98.11% |
| CHEMBL3194 | P02766 | Transthyretin | 98.32% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.72% | 95.56% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 96.30% | 96.12% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.35% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.13% | 96.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.31% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.92% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.73% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.65% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.07% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.46% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.03% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163073416 |
| LOTUS | LTS0106488 |
| wikiData | Q104170579 |